ChemNet > CAS > 54705-91-8 2-(1H-pyrazol-1-yl)aniline
54705-91-8 2-(1H-pyrazol-1-yl)aniline
| Naam product |
2-(1H-pyrazol-1-yl)aniline |
| MF |
C9H9N3 |
| Molecuulgewicht |
159.1879 |
| InChI |
InChI=1/C9H9N3/c10-8-4-1-2-5-9(8)12-7-3-6-11-12/h1-7H,10H2 |
| CAS-nummer |
54705-91-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.2g/cm3 |
| Smeltpunt |
44℃ |
| Kookpunt |
305.4°C at 760 mmHg |
| Brekingsindex |
1.641 |
| Vlampunt |
138.5°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
