ChemNet > CAS > 54932-72-8 5-Bromo-2-chlorotoluene
54932-72-8 5-Bromo-2-chlorotoluene
Naam product |
5-Bromo-2-chlorotoluene |
Synoniemen |
4-bromo-1-chloro-2-methylbenzene |
MF |
C7H6BrCl |
Molecuulgewicht |
205.4795 |
InChI |
InChI=1/C7H6BrCl/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
CAS-nummer |
54932-72-8 |
Moleculaire Structuur |
|
Dichtheid |
1.535g/cm3 |
Kookpunt |
216.9°C at 760 mmHg |
Brekingsindex |
1.566 |
Vlampunt |
99.1°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|