ChemNet > CAS > 552-32-9 2-Nitroacetanilide
552-32-9 2-Nitroacetanilide
Naam product |
2-Nitroacetanilide |
Synoniemen |
o-Nitroacetanilide; 2'-Nitroacetanilide; AI3-08843; NSC 1313; Acetamide, N-(2-nitrophenyl)-; Acetanilide, 2'-nitro- (8CI); N-(2-nitrophenyl)acetamide |
MF |
C8H8N2O3 |
Molecuulgewicht |
180.1607 |
InChI |
InChI=1/C8H8N2O3/c1-6(11)9-7-4-2-3-5-8(7)10(12)13/h2-5H,1H3,(H,9,11) |
CAS-nummer |
552-32-9 |
EINECS |
209-009-6 |
Moleculaire Structuur |
|
Dichtheid |
1.34g/cm3 |
Smeltpunt |
92-94℃ |
Kookpunt |
388.1°C at 760 mmHg |
Brekingsindex |
1.617 |
Vlampunt |
188.5°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|