ChemNet > CAS > 553-17-3 bis(2-methoxyphenyl) carbonate
553-17-3 bis(2-methoxyphenyl) carbonate
Naam product |
bis(2-methoxyphenyl) carbonate |
Synoniemen |
diguaiacyl carbonate; guaiacyl carbonate; Guaiacol carbonate |
MF |
C15H14O5 |
Molecuulgewicht |
274.2687 |
InChI |
InChI=1/C15H14O5/c1-17-11-7-3-5-9-13(11)19-15(16)20-14-10-6-4-8-12(14)18-2/h3-10H,1-2H3 |
CAS-nummer |
553-17-3 |
EINECS |
209-034-2 |
Moleculaire Structuur |
|
Dichtheid |
1.208g/cm3 |
Kookpunt |
392.6°C at 760 mmHg |
Brekingsindex |
1.552 |
Vlampunt |
173.7°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|