ChemNet > CAS > 556-48-9 1,4-Cyclohexanediol, mixture of cis and trans
556-48-9 1,4-Cyclohexanediol, mixture of cis and trans
Naam product |
1,4-Cyclohexanediol, mixture of cis and trans |
Synoniemen |
Cyclohexanediolcistrans; 1,4-Cyclohexanediol; Hexahydrohydroquinone; 1,4-Hexandiol; Quinitol; 1,4-Bis(hydroxymethyl)-cyclohexane; cyclohexane-1,4-diol; trans-cyclohexane-1,4-diol; 1,4-Cyclohexanediol (cis & trans mixture) |
MF |
C6H12O2 |
Molecuulgewicht |
116.1583 |
InChI |
InChI=1/C6H12O2/c7-5-1-2-6(8)4-3-5/h5-8H,1-4H2/t5-,6- |
CAS-nummer |
556-48-9 |
EINECS |
209-126-2 |
Moleculaire Structuur |
|
Dichtheid |
1.156g/cm3 |
Smeltpunt |
98-100℃ |
Kookpunt |
252.4°C at 760 mmHg |
Brekingsindex |
1.526 |
Vlampunt |
65.6°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:;
|
|