ChemNet > CAS > 55836-69-6 3-ethoxybenzamide
55836-69-6 3-ethoxybenzamide
Naam product |
3-ethoxybenzamide |
Synoniemen |
m-Ethoxybenzamide; Benzamide, 3-ethoxy- |
MF |
C9H11NO2 |
Molecuulgewicht |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3,(H2,10,11) |
CAS-nummer |
55836-69-6 |
EINECS |
259-846-6 |
Moleculaire Structuur |
|
Dichtheid |
1.111g/cm3 |
Smeltpunt |
138-140℃ |
Kookpunt |
293.4°C at 760 mmHg |
Brekingsindex |
1.538 |
Vlampunt |
145.8°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|