ChemNet > CAS > 56276-49-4 3-Phenylazoacetylacetone
56276-49-4 3-Phenylazoacetylacetone
Naam product |
3-Phenylazoacetylacetone |
Synoniemen |
3-Phenylazoacethylacetone; 3-Phenylazo-2,4-pentanedione; 3-[(E)-phenyldiazenyl]pentane-2,4-dione |
MF |
C11H12N2O2 |
Molecuulgewicht |
204.2252 |
InChI |
InChI=1/C11H12N2O2/c1-8(14)11(9(2)15)13-12-10-6-4-3-5-7-10/h3-7,11H,1-2H3/b13-12+ |
CAS-nummer |
56276-49-4 |
EINECS |
260-089-9 |
Moleculaire Structuur |
|
Dichtheid |
1.11g/cm3 |
Smeltpunt |
86-90℃ |
Kookpunt |
269.2°C at 760 mmHg |
Brekingsindex |
1.546 |
Vlampunt |
107.9°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|