ChemNet > CAS > 5660-91-3 Phencyclone
5660-91-3 Phencyclone
Naam product |
Phencyclone |
Synoniemen |
1,3-Diphenyl-2H-cyclopenta(l)phenanthren-2-one; 1,3-Diphenyl-2H-cyclopenta[l]phenanthren-2-one; 2H-cyclopenta[l]phenanthren-2-one, 1,3-diphenyl- |
MF |
C29H18O |
Molecuulgewicht |
382.4526 |
InChI |
InChI=1/C29H18O/c30-29-25(19-11-3-1-4-12-19)27-23-17-9-7-15-21(23)22-16-8-10-18-24(22)28(27)26(29)20-13-5-2-6-14-20/h1-18H |
CAS-nummer |
5660-91-3 |
EINECS |
227-112-4 |
Moleculaire Structuur |
|
Dichtheid |
1.29g/cm3 |
Kookpunt |
673.6°C at 760 mmHg |
Brekingsindex |
1.739 |
Vlampunt |
294.9°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|