ChemNet > CAS > 57012-20-1 (1,3-dimethyl-1H-pyrazol-5-yl)methanol
57012-20-1 (1,3-dimethyl-1H-pyrazol-5-yl)methanol
Naam product |
(1,3-dimethyl-1H-pyrazol-5-yl)methanol |
MF |
C6H10N2O |
Molecuulgewicht |
126.1564 |
InChI |
InChI=1/C6H10N2O/c1-5-3-6(4-9)8(2)7-5/h3,9H,4H2,1-2H3 |
CAS-nummer |
57012-20-1 |
Moleculaire Structuur |
|
Dichtheid |
1.13g/cm3 |
Kookpunt |
248.6°C at 760 mmHg |
Brekingsindex |
1.543 |
Vlampunt |
104.1°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|