ChemNet > CAS > 575-43-9 1,6-Dimethylnaphthalene
575-43-9 1,6-Dimethylnaphthalene
Naam product |
1,6-Dimethylnaphthalene |
Synoniemen |
AI3-17608; HSDB 6024; NSC 52966; Naphthalene, 1,6-dimethyl-; Naphthalene, 1,6-dimethyl- (8CI)(9CI) |
MF |
C12H12 |
Molecuulgewicht |
156.2237 |
InChI |
InChI=1/C12H12/c1-9-6-7-12-10(2)4-3-5-11(12)8-9/h3-8H,1-2H3 |
CAS-nummer |
575-43-9 |
EINECS |
209-385-1 |
Moleculaire Structuur |
|
Dichtheid |
1g/cm3 |
Kookpunt |
264.4°C at 760 mmHg |
Brekingsindex |
1.604 |
Vlampunt |
110.5°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|