ChemNet > CAS > 5819-40-9 4-bromo-5-methylisoxazol-3-amine
5819-40-9 4-bromo-5-methylisoxazol-3-amine
Naam product |
4-bromo-5-methylisoxazol-3-amine |
Synoniemen |
3-Amino-4-bromo-5-methylisoxazole; 4-bromo-3-methyl-1,2-oxazol-5-amine |
MF |
C4H5BrN2O |
Molecuulgewicht |
176.9993 |
InChI |
InChI=1/C4H5BrN2O/c1-2-3(5)4(6)8-7-2/h6H2,1H3 |
CAS-nummer |
5819-40-9 |
Moleculaire Structuur |
|
Dichtheid |
1.767g/cm3 |
Smeltpunt |
73℃ |
Kookpunt |
273.538°C at 760 mmHg |
Brekingsindex |
1.581 |
Vlampunt |
119.232°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|