ChemNet > CAS > 589-62-8 4-octanol
589-62-8 4-octanol
Naam product |
4-octanol |
Synoniemen |
n-Butyl n-propyl carbinol; octan-4-ol |
MF |
C8H18O |
Molecuulgewicht |
130.2279 |
InChI |
InChI=1/C8H18O/c1-3-5-7-8(9)6-4-2/h8-9H,3-7H2,1-2H3 |
CAS-nummer |
589-62-8 |
EINECS |
209-654-3 |
Moleculaire Structuur |
|
Dichtheid |
0.821g/cm3 |
Kookpunt |
179.2°C at 760 mmHg |
Brekingsindex |
1.426 |
Vlampunt |
71.1°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|