ChemNet > CAS > 5961-55-7 4-Methoxy-1-naphthonitrile
5961-55-7 4-Methoxy-1-naphthonitrile
Naam product |
4-Methoxy-1-naphthonitrile |
Synoniemen |
1-Cyano-4-methoxynaphtalene; 1-Cyano-4-methoxynaphthalene; 4-methoxynaphthalene-1-carbonitrile |
MF |
C12H9NO |
Molecuulgewicht |
183.206 |
InChI |
InChI=1/C12H9NO/c1-14-12-7-6-9(8-13)10-4-2-3-5-11(10)12/h2-7H,1H3 |
CAS-nummer |
5961-55-7 |
EINECS |
227-734-6 |
Moleculaire Structuur |
|
Dichtheid |
1.16g/cm3 |
Smeltpunt |
99-102℃ |
Kookpunt |
364.6°C at 760 mmHg |
Brekingsindex |
1.622 |
Vlampunt |
153.7°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|