ChemNet > CAS > 598-52-7 N-Methylthiourea
598-52-7 N-Methylthiourea
Naam product |
N-Methylthiourea |
Synoniemen |
N-Methyl thiourea; 1-methylthiourea |
MF |
C2H6N2S |
Molecuulgewicht |
90.1474 |
InChI |
InChI=1/C2H6N2S/c1-4-2(3)5/h1H3,(H3,3,4,5) |
CAS-nummer |
598-52-7 |
EINECS |
209-936-6 |
Moleculaire Structuur |
|
Dichtheid |
1.14g/cm3 |
Smeltpunt |
118-123℃ |
Kookpunt |
141.1°C at 760 mmHg |
Brekingsindex |
1.564 |
Vlampunt |
39.1°C |
Gevaarsymbolen |
T:Toxic;
|
Risico-codes |
R25:Toxic if swallowed.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|