ChemNet > CAS > 59918-68-2 3-furancarbothioamide
59918-68-2 3-furancarbothioamide
| Naam product |
3-furancarbothioamide |
| Synoniemen |
furan-3-carbothioamide |
| MF |
C5H5NOS |
| Molecuulgewicht |
127.1643 |
| InChI |
InChI=1/C5H5NOS/c6-5(8)4-1-2-7-3-4/h1-3H,(H2,6,8) |
| CAS-nummer |
59918-68-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.287g/cm3 |
| Smeltpunt |
74℃ |
| Kookpunt |
219.6°C at 760 mmHg |
| Brekingsindex |
1.62 |
| Vlampunt |
86.6°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
