ChemNet > CAS > 602-00-6 3-Hydroxy-2-nitrobenzoic acid
602-00-6 3-Hydroxy-2-nitrobenzoic acid
Naam product |
3-Hydroxy-2-nitrobenzoic acid |
MF |
C7H5NO5 |
Molecuulgewicht |
183.1183 |
InChI |
InChI=1/C7H5NO5/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3,9H,(H,10,11) |
CAS-nummer |
602-00-6 |
Moleculaire Structuur |
|
Dichtheid |
1.631g/cm3 |
Kookpunt |
362.9°C at 760 mmHg |
Brekingsindex |
1.663 |
Vlampunt |
166.7°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|