ChemNet > CAS > 610-96-8 Methyl 2-chlorobenzoate
610-96-8 Methyl 2-chlorobenzoate
Naam product |
Methyl 2-chlorobenzoate |
Synoniemen |
Chlorobenzoic acid methyl ester; O-Chlorobenzoic Acid Methyl Ester; 2-Chlorobenzoic Acid Methyl Ester |
MF |
C8H7ClO2 |
Molecuulgewicht |
170.593 |
InChI |
InChI=1/C8H7ClO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
CAS-nummer |
610-96-8 |
EINECS |
210-242-0 |
Moleculaire Structuur |
|
Dichtheid |
1.224g/cm3 |
Kookpunt |
225.4°C at 760 mmHg |
Brekingsindex |
1.528 |
Vlampunt |
101.7°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|