ChemNet > CAS > 611-23-4 2-Nitrosotoluene
611-23-4 2-Nitrosotoluene
Naam product |
2-Nitrosotoluene |
Synoniemen |
1-Methyl-2-nitrosobenzene; 2-Methyl-1-nitrosobenzene; 2-Methylnitrosobenzene; 4-05-00-00844 (Beilstein Handbook Reference); BRN 1927295; CCRIS 480; NSC 66507; o-Methylnitrosobenzene; o-Nitrosotoluene; Benzene, 1-methyl-2-nitroso- (9CI); Toluene, o-nitroso- |
MF |
C7H7NO |
Molecuulgewicht |
121.1366 |
InChI |
InChI=1/C7H7NO/c1-6-4-2-3-5-7(6)8-9/h2-5H,1H3 |
CAS-nummer |
611-23-4 |
EINECS |
210-261-4 |
Moleculaire Structuur |
|
Dichtheid |
1.03g/cm3 |
Smeltpunt |
70-75℃ |
Kookpunt |
199.9°C at 760 mmHg |
Brekingsindex |
1.524 |
Vlampunt |
74.7°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|