ChemNet > CAS > 616-21-7 1,2-Dichlorobutane
616-21-7 1,2-Dichlorobutane
Naam product |
1,2-Dichlorobutane |
Synoniemen |
Butane, 1,2-dichloro-; HSDB 5717; NSC 93880 |
MF |
C4H8Cl2 |
Molecuulgewicht |
127.0123 |
InChI |
InChI=1/C4H8Cl2/c1-2-4(6)3-5/h4H,2-3H2,1H3 |
CAS-nummer |
616-21-7 |
EINECS |
210-469-5 |
Moleculaire Structuur |
|
Dichtheid |
1.079g/cm3 |
Kookpunt |
122.8°C at 760 mmHg |
Brekingsindex |
1.427 |
Vlampunt |
27.4°C |
Gevaarsymbolen |
|
Risico-codes |
R10:Flammable.;
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|