ChemNet > CAS > 620-79-1 Ethyl 2-benzylacetoacetate
620-79-1 Ethyl 2-benzylacetoacetate
Naam product |
Ethyl 2-benzylacetoacetate |
Synoniemen |
2-Benzylacetoacetic acid ethyl ester; ethyl 2-benzyl-3-oxobutanoate; ethyl (2S)-2-benzyl-3-oxobutanoate; ethyl (2R)-2-benzyl-3-oxobutanoate; Ethyl-2-benzylacetoacetate; Ethyl 2-acetyl-3-phenylpropionate |
MF |
C13H16O3 |
Molecuulgewicht |
220.2643 |
InChI |
InChI=1/C13H16O3/c1-3-16-13(15)12(10(2)14)9-11-7-5-4-6-8-11/h4-8,12H,3,9H2,1-2H3/t12-/m1/s1 |
CAS-nummer |
620-79-1 |
EINECS |
210-651-4 |
Moleculaire Structuur |
|
Dichtheid |
1.07g/cm3 |
Kookpunt |
276°C at 760 mmHg |
Brekingsindex |
1.502 |
Vlampunt |
132.3°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|