ChemNet > CAS > 621-63-6 2,2-diethoxyethanol
621-63-6 2,2-diethoxyethanol
| Naam product |
2,2-diethoxyethanol |
| Synoniemen |
Hydroxyacetaldehyde diethyl acetal; 2,2-diethoxy ethanol; glycolaldehyde diethyl acetal |
| MF |
C6H14O3 |
| Molecuulgewicht |
134.1736 |
| InChI |
InChI=1/C6H14O3/c1-3-8-6(5-7)9-4-2/h6-7H,3-5H2,1-2H3 |
| CAS-nummer |
621-63-6 |
| EINECS |
210-697-5 |
| Moleculaire Structuur |
|
| Dichtheid |
0.97g/cm3 |
| Kookpunt |
167°C at 760 mmHg |
| Brekingsindex |
1.418 |
| Vlampunt |
68.4°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
