ChemNet > CAS > 622-46-8 Phenyl carbamate
622-46-8 Phenyl carbamate
Naam product |
Phenyl carbamate |
Synoniemen |
AI3-50866; CCRIS 5071; NSC 66509; Carbamic acid, phenyl ester |
MF |
C7H7NO2 |
Molecuulgewicht |
137.136 |
InChI |
InChI=1/C7H7NO2/c8-7(9)10-6-4-2-1-3-5-6/h1-5H,(H2,8,9) |
CAS-nummer |
622-46-8 |
EINECS |
210-737-1 |
Moleculaire Structuur |
|
Dichtheid |
1.2g/cm3 |
Smeltpunt |
145-152℃ |
Kookpunt |
278.9°C at 760 mmHg |
Brekingsindex |
1.551 |
Vlampunt |
159.3°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|