ChemNet > CAS > 6282-00-4 NN-Dipropylformamide
6282-00-4 NN-Dipropylformamide
| Naam product |
NN-Dipropylformamide |
| Synoniemen |
N,N-Di-n-propylformamide; N,N-dipropylformamide |
| MF |
C7H15NO |
| Molecuulgewicht |
129.2001 |
| InChI |
InChI=1/C7H15NO/c1-3-5-8(7-9)6-4-2/h7H,3-6H2,1-2H3 |
| CAS-nummer |
6282-00-4 |
| Moleculaire Structuur |
|
| Dichtheid |
0.869g/cm3 |
| Kookpunt |
221.3°C at 760 mmHg |
| Brekingsindex |
1.429 |
| Vlampunt |
83.7°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/38:Irritating to eyes and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
