ChemNet > CAS > 632-22-4 1,1,3,3-Tetramethylurea
632-22-4 1,1,3,3-Tetramethylurea
| Naam product |
1,1,3,3-Tetramethylurea |
| Synoniemen |
Tetramethylurea |
| MF |
C5H12N2O |
| Molecuulgewicht |
116.16 |
| InChI |
InChI=1/C5H12N2O/c1-6(2)5(8)7(3)4/h1-4H3 |
| CAS-nummer |
632-22-4 |
| EINECS |
211-173-9 |
| Moleculaire Structuur |
|
| Dichtheid |
0.9879 |
| Smeltpunt |
-1℃ |
| Kookpunt |
174-178℃ |
| Brekingsindex |
1.4496-1.4516 |
| Vlampunt |
65℃ |
| Oplosbaarheid in water |
miscible |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R22:;
|
| Veiligheid Omschrijving |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
