ChemNet > CAS > 636-28-2 1,2,4,5-Tetrabromobenzene
636-28-2 1,2,4,5-Tetrabromobenzene
Naam product |
1,2,4,5-Tetrabromobenzene |
Synoniemen |
2,3,5,6-Tetrabromobenzene; NSC 27002; Benzene, 1,2,4,5-tetrabromo- |
MF |
C6H2Br4 |
Molecuulgewicht |
393.6961 |
InChI |
InChI=1/C6H2Br4/c7-3-1-4(8)6(10)2-5(3)9/h1-2H |
CAS-nummer |
636-28-2 |
EINECS |
211-253-3 |
Moleculaire Structuur |
|
Dichtheid |
2.553g/cm3 |
Smeltpunt |
180-182℃ |
Kookpunt |
327.5°C at 760 mmHg |
Brekingsindex |
1.661 |
Vlampunt |
148.5°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|