ChemNet > CAS > 637-53-6 Thioacetanilide
637-53-6 Thioacetanilide
Naam product |
Thioacetanilide |
Synoniemen |
98%; THIOACETANILIDE 99%; N-phenylethanethioamide |
MF |
C8H9NS |
Molecuulgewicht |
151.2288 |
InChI |
InChI=1/C8H9NS/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10) |
CAS-nummer |
637-53-6 |
EINECS |
211-288-4 |
Moleculaire Structuur |
|
Dichtheid |
1.16g/cm3 |
Smeltpunt |
76-79℃ |
Kookpunt |
225.121°C at 760 mmHg |
Brekingsindex |
1.654 |
Vlampunt |
89.95°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|