ChemNet > CAS > 6575-09-3 2-Chloro-6-methylbenzonitrile
6575-09-3 2-Chloro-6-methylbenzonitrile
Naam product |
2-Chloro-6-methylbenzonitrile |
Synoniemen |
6-Chloro-o-tolunitrile; 3-chloro-2-toluonitrile |
MF |
C8H6ClN |
Molecuulgewicht |
151.5929 |
InChI |
InChI=1/C8H6ClN/c1-6-3-2-4-8(9)7(6)5-10/h2-4H,1H3 |
CAS-nummer |
6575-09-3 |
EINECS |
229-499-5 |
Moleculaire Structuur |
|
Dichtheid |
1.19g/cm3 |
Smeltpunt |
78-83℃ |
Kookpunt |
241.1°C at 760 mmHg |
Brekingsindex |
1.553 |
Vlampunt |
110.1°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|