ChemNet > CAS > 6705-03-9 2-Amino-5-methoxybenzoic acid
6705-03-9 2-Amino-5-methoxybenzoic acid
Naam product |
2-Amino-5-methoxybenzoic acid |
Synoniemen |
5-Methoxyanthranilic acid; 2-Amino-5-methoxy-benzoic acid |
MF |
C8H8N2O |
Molecuulgewicht |
148.1619 |
InChI |
InChI=1/C8H8N2O/c1-11-7-2-3-8(10)6(4-7)5-9/h2-4H,10H2,1H3 |
CAS-nummer |
6705-03-9 |
Moleculaire Structuur |
|
Dichtheid |
1.17g/cm3 |
Smeltpunt |
148-152℃ |
Kookpunt |
302.2°C at 760 mmHg |
Brekingsindex |
1.569 |
Vlampunt |
136.6°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R22:;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|