ChemNet > CAS > 68282-47-3 2-phenyl-1H-imidazole-4-carbaldehyde
68282-47-3 2-phenyl-1H-imidazole-4-carbaldehyde
Naam product |
2-phenyl-1H-imidazole-4-carbaldehyde |
Synoniemen |
2-phenyl-1H-imidazole-5-carbaldehyde |
MF |
C10H8N2O |
Molecuulgewicht |
172.1833 |
InChI |
InChI=1/C10H8N2O/c13-7-9-6-11-10(12-9)8-4-2-1-3-5-8/h1-7H,(H,11,12) |
CAS-nummer |
68282-47-3 |
Moleculaire Structuur |
|
Dichtheid |
1.248g/cm3 |
Smeltpunt |
167℃ |
Kookpunt |
418.9°C at 760 mmHg |
Brekingsindex |
1.646 |
Vlampunt |
208.7°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R21/22:Harmful in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|