ChemNet > CAS > 68837-59-2 4-Bromo-2-methylbenzoic acid
68837-59-2 4-Bromo-2-methylbenzoic acid
| Naam product |
4-Bromo-2-methylbenzoic acid |
| Synoniemen |
2-Methyl-4-Bromobenzoic acid; RARECHEM AL BO 0455; 4-Bromo-o-toluic acid |
| MF |
C8H7BrO2 |
| Molecuulgewicht |
215.044 |
| InChI |
InChI=1/C8H7BrO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| CAS-nummer |
68837-59-2 |
| EINECS |
272-437-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.599g/cm3 |
| Smeltpunt |
180-184℃ |
| Kookpunt |
310.1°C at 760 mmHg |
| Brekingsindex |
1.595 |
| Vlampunt |
141.3°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R22:;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
