ChemNet > CAS > 69321-60-4 2,6-Dibromotoluene
69321-60-4 2,6-Dibromotoluene
| Naam product |
2,6-Dibromotoluene |
| Synoniemen |
1,3-dibromo-2-methylbenzene |
| MF |
C7H6Br2 |
| Molecuulgewicht |
249.9305 |
| InChI |
InChI=1/C7H6Br2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| CAS-nummer |
69321-60-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.81g/cm3 |
| Kookpunt |
246°C at 760 mmHg |
| Brekingsindex |
1.587 |
| Vlampunt |
106.6°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/38:Irritating to eyes and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
