ChemNet > CAS > 697-90-5 2,4-Dichloro-6-iodoaniline
697-90-5 2,4-Dichloro-6-iodoaniline
Naam product |
2,4-Dichloro-6-iodoaniline |
MF |
C6H4Cl2IN |
Molecuulgewicht |
287.9131 |
InChI |
InChI=1/C6H4Cl2IN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
CAS-nummer |
697-90-5 |
Moleculaire Structuur |
|
Dichtheid |
2.091g/cm3 |
Kookpunt |
303.8°C at 760 mmHg |
Brekingsindex |
1.699 |
Vlampunt |
137.5°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|