ChemNet > CAS > 69778-83-2 4-Methoxy-3-pyrrolin-2-one
69778-83-2 4-Methoxy-3-pyrrolin-2-one
Naam product |
4-Methoxy-3-pyrrolin-2-one |
Synoniemen |
1,5-Dihydro-4-methoxy-2H-pyrrol-2-on; 4-methoxy-1,5-dihydro-2H-pyrrol-2-one |
MF |
C5H7NO2 |
Molecuulgewicht |
113.1146 |
InChI |
InChI=1/C5H7NO2/c1-8-4-2-5(7)6-3-4/h2H,3H2,1H3,(H,6,7) |
CAS-nummer |
69778-83-2 |
Moleculaire Structuur |
|
Dichtheid |
1.16g/cm3 |
Smeltpunt |
130-133℃ |
Kookpunt |
349.6°C at 760 mmHg |
Brekingsindex |
1.495 |
Vlampunt |
165.2°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|