ChemNet > CAS > 699-08-1 4-Iodophenetole
699-08-1 4-Iodophenetole
Naam product |
4-Iodophenetole |
Synoniemen |
4-Ethoxy-4-iodobenzene; Ethyl 4-iodophenyl ether; 1-ethoxy-4-iodobenzene; 4-Ethoxyiodobenzene, 4-Iodophenyl ethyl ether; 1-Iodo-4-Ethyloxybenzene; p-Iodophenetole |
MF |
C8H9IO |
Molecuulgewicht |
248.0609 |
InChI |
InChI=1/C8H9IO/c1-2-10-8-5-3-7(9)4-6-8/h3-6H,2H2,1H3 |
CAS-nummer |
699-08-1 |
Moleculaire Structuur |
|
Dichtheid |
1.631g/cm3 |
Smeltpunt |
27-29℃ |
Kookpunt |
251°C at 760 mmHg |
Brekingsindex |
1.578 |
Vlampunt |
105.6°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|