ChemNet > CAS > 7197-96-8 2,3-cycloheptenopyridine
7197-96-8 2,3-cycloheptenopyridine
Naam product |
2,3-cycloheptenopyridine |
MF |
C10H13N |
Molecuulgewicht |
147.2169 |
InChI |
InChI=1/C10H13N/c1-2-5-9-6-4-8-11-10(9)7-3-1/h4,6,8H,1-3,5,7H2 |
CAS-nummer |
7197-96-8 |
EINECS |
230-568-7 |
Moleculaire Structuur |
|
Dichtheid |
0.999g/cm3 |
Kookpunt |
224.9°C at 760 mmHg |
Brekingsindex |
1.533 |
Vlampunt |
93.3°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|