ChemNet > CAS > 72571-06-3 5-(4-bromophenyl)-1,3-oxazole
72571-06-3 5-(4-bromophenyl)-1,3-oxazole
Naam product |
5-(4-bromophenyl)-1,3-oxazole |
MF |
C9H6BrNO |
Molecuulgewicht |
224.054 |
InChI |
InChI=1/C9H6BrNO/c10-8-3-1-7(2-4-8)9-5-11-6-12-9/h1-6H |
CAS-nummer |
72571-06-3 |
Moleculaire Structuur |
|
Dichtheid |
1.524g/cm3 |
Smeltpunt |
78℃ |
Kookpunt |
315.8°C at 760 mmHg |
Brekingsindex |
1.58 |
Vlampunt |
144.8°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|