ChemNet > CAS > 72752-52-4 2-Piperidinobenzonitrile
72752-52-4 2-Piperidinobenzonitrile
Naam product |
2-Piperidinobenzonitrile |
Synoniemen |
2-(1-Piperidino)benzonitrile; 2-piperidin-1-ylbenzonitrile |
MF |
C12H14N2 |
Molecuulgewicht |
186.253 |
InChI |
InChI=1/C12H14N2/c13-10-11-6-2-3-7-12(11)14-8-4-1-5-9-14/h2-3,6-7H,1,4-5,8-9H2 |
CAS-nummer |
72752-52-4 |
EINECS |
427-330-1 |
Moleculaire Structuur |
|
Dichtheid |
1.09g/cm3 |
Smeltpunt |
48-50℃ |
Kookpunt |
336.9°C at 760 mmHg |
Brekingsindex |
1.577 |
Vlampunt |
147.5°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|