ChemNet > CAS > 7295-44-5 p-Bromovalerophenone
7295-44-5 p-Bromovalerophenone
| Naam product |
p-Bromovalerophenone |
| Synoniemen |
4'-bromovalerophenone; 1-(4-Bromophenyl)pentan-1-one; 1-pentanone, 1-(4-bromophenyl)-; p-Bromophenyl butyl ketone |
| MF |
C11H13BrO |
| Molecuulgewicht |
241.1243 |
| InChI |
InChI=1/C11H13BrO/c1-2-3-4-11(13)9-5-7-10(12)8-6-9/h5-8H,2-4H2,1H3 |
| CAS-nummer |
7295-44-5 |
| EINECS |
230-729-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.291g/cm3 |
| Smeltpunt |
34-36℃ |
| Kookpunt |
291.3°C at 760 mmHg |
| Brekingsindex |
1.532 |
| Vlampunt |
59.7°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
