ChemNet > CAS > 7391-28-8 4-Methylbenzoylacetonitrile
7391-28-8 4-Methylbenzoylacetonitrile
Naam product |
4-Methylbenzoylacetonitrile |
Synoniemen |
p-Toluoylacetonitrile; 3-oxo-3-p-tolylpropanenitrile; 3-(4-methylphenyl)-3-oxopropanenitrile |
MF |
C10H9NO |
Molecuulgewicht |
159.1846 |
InChI |
InChI=1/C10H9NO/c1-8-2-4-9(5-3-8)10(12)6-7-11/h2-5H,6H2,1H3 |
CAS-nummer |
7391-28-8 |
Moleculaire Structuur |
|
Dichtheid |
1.081g/cm3 |
Smeltpunt |
100-102℃ |
Kookpunt |
318.2°C at 760 mmHg |
Brekingsindex |
1.532 |
Vlampunt |
146.2°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|