ChemNet > CAS > 74003-55-7 3,4-Dibromobenzaldehyde
74003-55-7 3,4-Dibromobenzaldehyde
| Naam product |
3,4-Dibromobenzaldehyde |
| Synoniemen |
3,4-Dibromo-benzaldehyde |
| MF |
C7H4Br2O |
| Molecuulgewicht |
263.9141 |
| InChI |
InChI=1/C7H4Br2O/c8-6-2-1-5(4-10)3-7(6)9/h1-4H |
| CAS-nummer |
74003-55-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.977g/cm3 |
| Kookpunt |
303.6°C at 760 mmHg |
| Brekingsindex |
1.645 |
| Vlampunt |
123°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
