ChemNet > CAS > 7424-54-6 3,5-Heptanedione
7424-54-6 3,5-Heptanedione
Naam product |
3,5-Heptanedione |
Synoniemen |
heptane-3,5-dione; (4Z)-5-hydroxyhept-4-en-3-one; 3,5-HEPTANDIONE |
MF |
C7H12O2 |
Molecuulgewicht |
128.169 |
InChI |
InChI=1/C7H12O2/c1-3-6(8)5-7(9)4-2/h5,8H,3-4H2,1-2H3/b6-5- |
CAS-nummer |
7424-54-6 |
EINECS |
231-054-5 |
Moleculaire Structuur |
|
Dichtheid |
0.97g/cm3 |
Kookpunt |
216.1°C at 760 mmHg |
Brekingsindex |
1.456 |
Vlampunt |
86.3°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|