ChemNet > CAS > 77-04-3 Pyrithyldione
77-04-3 Pyrithyldione
| Naam product |
Pyrithyldione |
| Synoniemen |
3,3-Diethyl-2,4(1H,3H)-pyridinedione; 3,3-diethylpyridine-2,4(1H,3H)-dione |
| MF |
C9H13NO2 |
| Molecuulgewicht |
167.205 |
| InChI |
InChI=1/C9H13NO2/c1-3-9(4-2)7(11)5-6-10-8(9)12/h5-6H,3-4H2,1-2H3,(H,10,12) |
| CAS-nummer |
77-04-3 |
| EINECS |
201-000-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.029g/cm3 |
| Kookpunt |
330.2°C at 760 mmHg |
| Brekingsindex |
1.464 |
| Vlampunt |
147.8°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
