ChemNet > CAS > 776-75-0 1-benzoylpiperidine
776-75-0 1-benzoylpiperidine
Naam product |
1-benzoylpiperidine |
Synoniemen |
N-Benzoylpiperidine; 1-Benzoylpiperidine; 5-20-02-00450 (Beilstein Handbook Reference); AI3-05550; BRN 0136611; Benzoic acid N-piperidide; Benzoic acid, piperidide; Benzoylpiperidine; LG 20104; N-Benzoylpiperidin; N-Benzoylpiperidin [German]; NSC 1992; NSC 26344; P 162; Protectine I; R 162; alpha-Repellin; Piperidine, 1-benzoyl-; phenyl(piperidin-1-yl)methanone; N,N-dibenzylbenzamide |
MF |
C21H19NO |
Molecuulgewicht |
301.3817 |
InChI |
InChI=1/C21H19NO/c23-21(20-14-8-3-9-15-20)22(16-18-10-4-1-5-11-18)17-19-12-6-2-7-13-19/h1-15H,16-17H2 |
CAS-nummer |
776-75-0 |
EINECS |
212-280-3 |
Moleculaire Structuur |
|
Dichtheid |
1.132g/cm3 |
Kookpunt |
493.2°C at 760 mmHg |
Brekingsindex |
1.621 |
Vlampunt |
232.1°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|