ChemNet > CAS > 825-44-5 Thianaphthene-1,1-dioxide
825-44-5 Thianaphthene-1,1-dioxide
| Naam product |
Thianaphthene-1,1-dioxide |
| Synoniemen |
Thianaphthene 1,1-dioxide; Benzo[b]thiophene 1,1-dioxide; 1-benzothiophene 1,1-dioxide |
| MF |
C8H6O2S |
| Molecuulgewicht |
166.197 |
| InChI |
InChI=1/C8H6O2S/c9-11(10)6-5-7-3-1-2-4-8(7)11/h1-6H |
| CAS-nummer |
825-44-5 |
| EINECS |
212-544-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.403g/cm3 |
| Smeltpunt |
137-138℃ |
| Kookpunt |
371.1°C at 760 mmHg |
| Brekingsindex |
1.64 |
| Vlampunt |
244°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
