CAS No: 1656-14-0;4355-59-3;473-96-1;82882-12-0, Chemical Name: 4H-1,2,4-triazole-3,4,5-triamine
the physical and chemical property of 1656-14-0;4355-59-3;473-96-1;82882-12-0, 4H-1,2,4-triazole-3,4,5-triamine is provided by ChemNet.com
ChemNet > CAS > 1656-14-0;4355-59-3;473-96-1;82882-12-0 4H-1,2,4-triazole-3,4,5-triamine
1656-14-0;4355-59-3;473-96-1;82882-12-0 4H-1,2,4-triazole-3,4,5-triamine
Naam product |
4H-1,2,4-triazole-3,4,5-triamine |
Synoniemen |
|
MF |
C2H6N6 |
Molecuulgewicht |
114.1092 |
InChI |
InChI=1/C2H6N6/c3-1-6-7-2(4)8(1)5/h5H2,(H2,3,6)(H2,4,7) |
CAS-nummer |
1656-14-0;4355-59-3;473-96-1;82882-12-0 |
Moleculaire Structuur |
|
Dichtheid |
2.45g/cm3 |
Kookpunt |
505.2°C at 760 mmHg |
Brekingsindex |
2.122 |
Vlampunt |
259.3°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|