ChemNet > CAS > 83-27-2 Diethyl sec-Butylmalonate
83-27-2 Diethyl sec-Butylmalonate
Naam product |
Diethyl sec-Butylmalonate |
Synoniemen |
Butylmalonicaciddiethylester; sec-Butylmalonic acid diethyl ester; diethyl butan-2-ylpropanedioate; diethyl [(1S)-1-methylpropyl]propanedioate; diethyl [(1R)-1-methylpropyl]propanedioate |
MF |
C11H20O4 |
Molecuulgewicht |
216.2741 |
InChI |
InChI=1/C11H20O4/c1-5-8(4)9(10(12)14-6-2)11(13)15-7-3/h8-9H,5-7H2,1-4H3/t8-/m1/s1 |
CAS-nummer |
83-27-2 |
EINECS |
201-463-3 |
Moleculaire Structuur |
|
Dichtheid |
0.992g/cm3 |
Kookpunt |
247.5°C at 760 mmHg |
Brekingsindex |
1.431 |
Vlampunt |
103.1°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|