ChemNet > CAS > 84-60-6 2,6-Dihydroxyanthraquinone
84-60-6 2,6-Dihydroxyanthraquinone
Naam product |
2,6-Dihydroxyanthraquinone |
MF |
C14H8O4 |
Molecuulgewicht |
240.2109 |
InChI |
InChI=1/C14H8O4/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6,15-16H |
CAS-nummer |
84-60-6 |
EINECS |
201-544-3 |
Moleculaire Structuur |
|
Dichtheid |
1.54g/cm3 |
Smeltpunt |
320℃ |
Kookpunt |
442.1°C at 760 mmHg |
Brekingsindex |
1.732 |
Vlampunt |
235.3°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|