ChemNet > CAS > 84562-48-1 4-Dimethylamino-2-methoxybenzaldehyde
84562-48-1 4-Dimethylamino-2-methoxybenzaldehyde
Naam product |
4-Dimethylamino-2-methoxybenzaldehyde |
MF |
C10H13NO2 |
Molecuulgewicht |
179.2157 |
InChI |
InChI=1/C10H13NO2/c1-11(2)9-5-4-8(7-12)10(6-9)13-3/h4-7H,1-3H3 |
CAS-nummer |
84562-48-1 |
Moleculaire Structuur |
|
Dichtheid |
1.098g/cm3 |
Smeltpunt |
59-60℃ |
Kookpunt |
305.9°C at 760 mmHg |
Brekingsindex |
1.576 |
Vlampunt |
138.8°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|