ChemNet > CAS > 86-79-3 2-Hydroxycarbazole
86-79-3 2-Hydroxycarbazole
Naam product |
2-Hydroxycarbazole |
Synoniemen |
carbazol-2-ol; 9H-carbazol-2-ol |
MF |
C12H9NO |
Molecuulgewicht |
183.206 |
InChI |
InChI=1/C12H9NO/c14-8-5-6-10-9-3-1-2-4-11(9)13-12(10)7-8/h1-7,13-14H |
CAS-nummer |
86-79-3 |
EINECS |
201-699-7 |
Moleculaire Structuur |
|
Dichtheid |
1.362g/cm3 |
Smeltpunt |
273-275℃ |
Kookpunt |
431.4°C at 760 mmHg |
Brekingsindex |
1.815 |
Vlampunt |
214.7°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|