ChemNet > CAS > 878-00-2 4-Acetoxybenzaldehyde
878-00-2 4-Acetoxybenzaldehyde
Naam product |
4-Acetoxybenzaldehyde |
Synoniemen |
4-Formylphenyl acetate |
MF |
C9H8O3 |
Molecuulgewicht |
164.158 |
InChI |
InChI=1/C9H8O3/c1-7(11)12-9-4-2-8(6-10)3-5-9/h2-6H,1H3 |
CAS-nummer |
878-00-2 |
EINECS |
212-898-3 |
Moleculaire Structuur |
|
Dichtheid |
1.183g/cm3 |
Kookpunt |
275°C at 760 mmHg |
Brekingsindex |
1.552 |
Vlampunt |
119.4°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|